C28H31N3O2 — CID 5030237
N-[1-(1-adamantyl)ethyl]-3-benzyl-4-oxophthalazine-1-carboxamide (PubChem CID 5030237) has the molecular formula C28H31N3O2 and a molecular weight of 441.58 g/mol. Its IUPAC name is N-[1-(1-adamantyl)ethyl]-3-benzyl-4-oxophthalazine-1-carboxamide.
| Compound Name | N-[1-(1-adamantyl)ethyl]-3-benzyl-4-oxophthalazine-1-carboxamide |
|---|---|
| PubChem CID | 5030237 |
| Molecular Formula | C28H31N3O2 |
| Molecular Weight | 441.58 g/mol |
| Exact Mass | 441.24 |
| IUPAC Name | N-[1-(1-adamantyl)ethyl]-3-benzyl-4-oxophthalazine-1-carboxamide |
| SMILES | CC(NC(=O)c1nn(Cc2ccccc2)c(=O)c2ccccc12)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C28H31N3O2/c1-18(28-14-20-11-21(15-28)13-22(12-20)16-28)29-26(32)25-23-9-5-6-10-24(23)27(33)31(30-25)17-19-7-3-2-4-8-19/h2-10,18,20-22H,11-17H2,1H3,(H,29,32) |
| InChIKey | YKTVPUUQETZQJD-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.58 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |