C24H30ClN3O — CID 7929420
N-[(1R)-1-(1-adamantyl)ethyl]-1-benzyl-5-chloro-3-methylpyrazole-4-carboxamide (PubChem CID 7929420) has the molecular formula C24H30ClN3O and a molecular weight of 411.98 g/mol. Its IUPAC name is N-[(1R)-1-(1-adamantyl)ethyl]-1-benzyl-5-chloro-3-methylpyrazole-4-carboxamide.
| Compound Name | N-[(1R)-1-(1-adamantyl)ethyl]-1-benzyl-5-chloro-3-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 7929420 |
| Molecular Formula | C24H30ClN3O |
| Molecular Weight | 411.98 g/mol |
| Exact Mass | 411.21 |
| IUPAC Name | N-[(1R)-1-(1-adamantyl)ethyl]-1-benzyl-5-chloro-3-methylpyrazole-4-carboxamide |
| SMILES | Cc1nn(Cc2ccccc2)c(Cl)c1C(=O)N[C@H](C)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C24H30ClN3O/c1-15-21(22(25)28(27-15)14-17-6-4-3-5-7-17)23(29)26-16(2)24-11-18-8-19(12-24)10-20(9-18)13-24/h3-7,16,18-20H,8-14H2,1-2H3,(H,26,29)/t16-,18?,19?,20?,24?/m1/s1 |
| InChIKey | CEEZFBIMZZERKN-SGGRRFJASA-N |
| XLogP | 5.23 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.98 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |