C26H31N3O4 — CID 41102378
[2-[[(1S)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl] 1-benzyl-6-oxopyridazine-3-carboxylate (PubChem CID 41102378) has the molecular formula C26H31N3O4 and a molecular weight of 449.55 g/mol. Its IUPAC name is [2-[[(1S)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl] 1-benzyl-6-oxopyridazine-3-carboxylate.
| Compound Name | [2-[[(1S)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl] 1-benzyl-6-oxopyridazine-3-carboxylate |
|---|---|
| PubChem CID | 41102378 |
| Molecular Formula | C26H31N3O4 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.23 |
| IUPAC Name | [2-[[(1S)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl] 1-benzyl-6-oxopyridazine-3-carboxylate |
| SMILES | C[C@H](NC(=O)COC(=O)c1ccc(=O)n(Cc2ccccc2)n1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C26H31N3O4/c1-17(26-12-19-9-20(13-26)11-21(10-19)14-26)27-23(30)16-33-25(32)22-7-8-24(31)29(28-22)15-18-5-3-2-4-6-18/h2-8,17,19-21H,9-16H2,1H3,(H,27,30)/t17-,19?,20?,21?,26?/m0/s1 |
| InChIKey | ROMSOUBSXSHQFH-MPVQEXEOSA-N |
| XLogP | 3.17 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |