C24H29N3O4 — CID 7675244
[2-[[(1R)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl] 3-methyl-4-oxophthalazine-1-carboxylate (PubChem CID 7675244) has the molecular formula C24H29N3O4 and a molecular weight of 423.51 g/mol. Its IUPAC name is [2-[[(1R)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl] 3-methyl-4-oxophthalazine-1-carboxylate.
| Compound Name | [2-[[(1R)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl] 3-methyl-4-oxophthalazine-1-carboxylate |
|---|---|
| PubChem CID | 7675244 |
| Molecular Formula | C24H29N3O4 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | [2-[[(1R)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl] 3-methyl-4-oxophthalazine-1-carboxylate |
| SMILES | C[C@@H](NC(=O)COC(=O)c1nn(C)c(=O)c2ccccc12)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C24H29N3O4/c1-14(24-10-15-7-16(11-24)9-17(8-15)12-24)25-20(28)13-31-23(30)21-18-5-3-4-6-19(18)22(29)27(2)26-21/h3-6,14-17H,7-13H2,1-2H3,(H,25,28)/t14-,15?,16?,17?,24?/m1/s1 |
| InChIKey | NLXWOIQQSFMQMC-ZJRYTYELSA-N |
| XLogP | 2.81 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |