C29H32N2O3 — CID 2922015
N-[1-(1-adamantyl)ethyl]-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanamide (PubChem CID 2922015) has the molecular formula C29H32N2O3 and a molecular weight of 456.59 g/mol. Its IUPAC name is N-[1-(1-adamantyl)ethyl]-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanamide.
| Compound Name | N-[1-(1-adamantyl)ethyl]-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanamide |
|---|---|
| PubChem CID | 2922015 |
| Molecular Formula | C29H32N2O3 |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.24 |
| IUPAC Name | N-[1-(1-adamantyl)ethyl]-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanamide |
| SMILES | CC(NC(=O)C(Cc1ccccc1)N1C(=O)c2ccccc2C1=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C29H32N2O3/c1-18(29-15-20-11-21(16-29)13-22(12-20)17-29)30-26(32)25(14-19-7-3-2-4-8-19)31-27(33)23-9-5-6-10-24(23)28(31)34/h2-10,18,20-22,25H,11-17H2,1H3,(H,30,32) |
| InChIKey | HLEJMAMGRXTQLV-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|