C22H22N2O3 — CID 5024298
N-cyclopentyl-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanamide (PubChem CID 5024298) has the molecular formula C22H22N2O3 and a molecular weight of 362.43 g/mol. Its IUPAC name is N-cyclopentyl-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanamide.
| Compound Name | N-cyclopentyl-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanamide |
|---|---|
| PubChem CID | 5024298 |
| Molecular Formula | C22H22N2O3 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | N-cyclopentyl-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanamide |
| SMILES | O=C(NC1CCCC1)C(Cc1ccccc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C22H22N2O3/c25-20(23-16-10-4-5-11-16)19(14-15-8-2-1-3-9-15)24-21(26)17-12-6-7-13-18(17)22(24)27/h1-3,6-9,12-13,16,19H,4-5,10-11,14H2,(H,23,25) |
| InChIKey | NCQCQNIBWYRQQI-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|