C23H23N3O5 — CID 23789936
N-cyclohexyl-2-(1,3-dioxoisoindol-2-yl)-3-(3-nitrophenyl)propanamide (PubChem CID 23789936) has the molecular formula C23H23N3O5 and a molecular weight of 421.45 g/mol. Its IUPAC name is N-cyclohexyl-2-(1,3-dioxoisoindol-2-yl)-3-(3-nitrophenyl)propanamide.
| Compound Name | N-cyclohexyl-2-(1,3-dioxoisoindol-2-yl)-3-(3-nitrophenyl)propanamide |
|---|---|
| PubChem CID | 23789936 |
| Molecular Formula | C23H23N3O5 |
| Molecular Weight | 421.45 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | N-cyclohexyl-2-(1,3-dioxoisoindol-2-yl)-3-(3-nitrophenyl)propanamide |
| SMILES | O=C(NC1CCCCC1)C(Cc1cccc([N+](=O)[O-])c1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C23H23N3O5/c27-21(24-16-8-2-1-3-9-16)20(14-15-7-6-10-17(13-15)26(30)31)25-22(28)18-11-4-5-12-19(18)23(25)29/h4-7,10-13,16,20H,1-3,8-9,14H2,(H,24,27) |
| InChIKey | IQHNJDHOQGCBJB-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.45 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|