C24H22F3N3O4 — CID 108932962
2-(1,3-dioxoisoindol-2-yl)-3-phenyl-N-[1-(2,2,2-trifluoroacetyl)piperidin-4-yl]propanamide (PubChem CID 108932962) has the molecular formula C24H22F3N3O4 and a molecular weight of 473.45 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-3-phenyl-N-[1-(2,2,2-trifluoroacetyl)piperidin-4-yl]propanamide.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-3-phenyl-N-[1-(2,2,2-trifluoroacetyl)piperidin-4-yl]propanamide |
|---|---|
| PubChem CID | 108932962 |
| Molecular Formula | C24H22F3N3O4 |
| Molecular Weight | 473.45 g/mol |
| Exact Mass | 473.16 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-3-phenyl-N-[1-(2,2,2-trifluoroacetyl)piperidin-4-yl]propanamide |
| SMILES | O=C(NC1CCN(C(=O)C(F)(F)F)CC1)C(Cc1ccccc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C24H22F3N3O4/c25-24(26,27)23(34)29-12-10-16(11-13-29)28-20(31)19(14-15-6-2-1-3-7-15)30-21(32)17-8-4-5-9-18(17)22(30)33/h1-9,16,19H,10-14H2,(H,28,31) |
| InChIKey | UXGJBGDKYXNBOI-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.45 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|