C25H27N3O4 — CID 108556080
N-[1-[2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoyl]piperidin-4-yl]propanamide (PubChem CID 108556080) has the molecular formula C25H27N3O4 and a molecular weight of 433.51 g/mol. Its IUPAC name is N-[1-[2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoyl]piperidin-4-yl]propanamide.
| Compound Name | N-[1-[2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoyl]piperidin-4-yl]propanamide |
|---|---|
| PubChem CID | 108556080 |
| Molecular Formula | C25H27N3O4 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | N-[1-[2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoyl]piperidin-4-yl]propanamide |
| SMILES | CCC(=O)NC1CCN(C(=O)C(Cc2ccccc2)N2C(=O)c3ccccc3C2=O)CC1 |
| InChI | InChI=1S/C25H27N3O4/c1-2-22(29)26-18-12-14-27(15-13-18)25(32)21(16-17-8-4-3-5-9-17)28-23(30)19-10-6-7-11-20(19)24(28)31/h3-11,18,21H,2,12-16H2,1H3,(H,26,29) |
| InChIKey | CGXULLZCZAZEIC-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|