C24H25N3O5 — CID 108564528
methyl N-[1-[2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoyl]piperidin-4-yl]carbamate (PubChem CID 108564528) has the molecular formula C24H25N3O5 and a molecular weight of 435.48 g/mol. Its IUPAC name is methyl N-[1-[2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoyl]piperidin-4-yl]carbamate.
| Compound Name | methyl N-[1-[2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoyl]piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 108564528 |
| Molecular Formula | C24H25N3O5 |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | methyl N-[1-[2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoyl]piperidin-4-yl]carbamate |
| SMILES | COC(=O)NC1CCN(C(=O)C(Cc2ccccc2)N2C(=O)c3ccccc3C2=O)CC1 |
| InChI | InChI=1S/C24H25N3O5/c1-32-24(31)25-17-11-13-26(14-12-17)23(30)20(15-16-7-3-2-4-8-16)27-21(28)18-9-5-6-10-19(18)22(27)29/h2-10,17,20H,11-15H2,1H3,(H,25,31) |
| InChIKey | OOLKKGMMGBIMFT-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|