C23H25N3O4 — CID 1167514
2-[(2R)-1-[4-(2-hydroxyethyl)piperazin-1-yl]-1-oxo-3-phenylpropan-2-yl]isoindole-1,3-dione (PubChem CID 1167514) has the molecular formula C23H25N3O4 and a molecular weight of 407.47 g/mol. Its IUPAC name is 2-[(2R)-1-[4-(2-hydroxyethyl)piperazin-1-yl]-1-oxo-3-phenylpropan-2-yl]isoindole-1,3-dione.
| Compound Name | 2-[(2R)-1-[4-(2-hydroxyethyl)piperazin-1-yl]-1-oxo-3-phenylpropan-2-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 1167514 |
| Molecular Formula | C23H25N3O4 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | 2-[(2R)-1-[4-(2-hydroxyethyl)piperazin-1-yl]-1-oxo-3-phenylpropan-2-yl]isoindole-1,3-dione |
| SMILES | O=C([C@@H](Cc1ccccc1)N1C(=O)c2ccccc2C1=O)N1CCN(CCO)CC1 |
| InChI | InChI=1S/C23H25N3O4/c27-15-14-24-10-12-25(13-11-24)23(30)20(16-17-6-2-1-3-7-17)26-21(28)18-8-4-5-9-19(18)22(26)29/h1-9,20,27H,10-16H2/t20-/m1/s1 |
| InChIKey | JPEJPTBGIFIOSI-HXUWFJFHSA-N |
| XLogP | 1.03 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|