C23H22Cl2N2O3 — CID 124579056
2-[(2R)-1-(azepan-1-yl)-1-oxo-3-phenylpropan-2-yl]-5,6-dichloroisoindole-1,3-dione (PubChem CID 124579056) has the molecular formula C23H22Cl2N2O3 and a molecular weight of 445.35 g/mol. Its IUPAC name is 2-[(2R)-1-(azepan-1-yl)-1-oxo-3-phenylpropan-2-yl]-5,6-dichloroisoindole-1,3-dione.
| Compound Name | 2-[(2R)-1-(azepan-1-yl)-1-oxo-3-phenylpropan-2-yl]-5,6-dichloroisoindole-1,3-dione |
|---|---|
| PubChem CID | 124579056 |
| Molecular Formula | C23H22Cl2N2O3 |
| Molecular Weight | 445.35 g/mol |
| Exact Mass | 444.10 |
| IUPAC Name | 2-[(2R)-1-(azepan-1-yl)-1-oxo-3-phenylpropan-2-yl]-5,6-dichloroisoindole-1,3-dione |
| SMILES | O=C([C@@H](Cc1ccccc1)N1C(=O)c2cc(Cl)c(Cl)cc2C1=O)N1CCCCCC1 |
| InChI | InChI=1S/C23H22Cl2N2O3/c24-18-13-16-17(14-19(18)25)22(29)27(21(16)28)20(12-15-8-4-3-5-9-15)23(30)26-10-6-1-2-7-11-26/h3-5,8-9,13-14,20H,1-2,6-7,10-12H2/t20-/m1/s1 |
| InChIKey | BJCPRXWFEWPGLU-HXUWFJFHSA-N |
| XLogP | 4.60 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.35 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|