C23H23ClN2O3 — CID 23877783
2-[1-(azepan-1-yl)-3-(3-chlorophenyl)-1-oxopropan-2-yl]isoindole-1,3-dione (PubChem CID 23877783) has the molecular formula C23H23ClN2O3 and a molecular weight of 410.90 g/mol. Its IUPAC name is 2-[1-(azepan-1-yl)-3-(3-chlorophenyl)-1-oxopropan-2-yl]isoindole-1,3-dione.
| Compound Name | 2-[1-(azepan-1-yl)-3-(3-chlorophenyl)-1-oxopropan-2-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 23877783 |
| Molecular Formula | C23H23ClN2O3 |
| Molecular Weight | 410.90 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | 2-[1-(azepan-1-yl)-3-(3-chlorophenyl)-1-oxopropan-2-yl]isoindole-1,3-dione |
| SMILES | O=C(C(Cc1cccc(Cl)c1)N1C(=O)c2ccccc2C1=O)N1CCCCCC1 |
| InChI | InChI=1S/C23H23ClN2O3/c24-17-9-7-8-16(14-17)15-20(23(29)25-12-5-1-2-6-13-25)26-21(27)18-10-3-4-11-19(18)22(26)28/h3-4,7-11,14,20H,1-2,5-6,12-13,15H2 |
| InChIKey | AZTVLZTVFKAEQW-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.90 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|