C25H24N4O4 — CID 108543313
3-[4-[2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoyl]-1,4-diazepan-1-yl]-3-oxopropanenitrile (PubChem CID 108543313) has the molecular formula C25H24N4O4 and a molecular weight of 444.49 g/mol. Its IUPAC name is 3-[4-[2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoyl]-1,4-diazepan-1-yl]-3-oxopropanenitrile.
| Compound Name | 3-[4-[2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoyl]-1,4-diazepan-1-yl]-3-oxopropanenitrile |
|---|---|
| PubChem CID | 108543313 |
| Molecular Formula | C25H24N4O4 |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | 3-[4-[2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoyl]-1,4-diazepan-1-yl]-3-oxopropanenitrile |
| SMILES | N#CCC(=O)N1CCCN(C(=O)C(Cc2ccccc2)N2C(=O)c3ccccc3C2=O)CC1 |
| InChI | InChI=1S/C25H24N4O4/c26-12-11-22(30)27-13-6-14-28(16-15-27)25(33)21(17-18-7-2-1-3-8-18)29-23(31)19-9-4-5-10-20(19)24(29)32/h1-5,7-10,21H,6,11,13-17H2 |
| InChIKey | OHZLAOMIMBJEEN-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 101.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|