C13H9Cl2NO4 — CID 67791576
(2S)-2-(3,4-dichloro-2,5-dioxopyrrol-1-yl)-3-phenylpropanoic acid (PubChem CID 67791576) has the molecular formula C13H9Cl2NO4 and a molecular weight of 314.12 g/mol. Its IUPAC name is (2S)-2-(3,4-dichloro-2,5-dioxopyrrol-1-yl)-3-phenylpropanoic acid.
| Compound Name | (2S)-2-(3,4-dichloro-2,5-dioxopyrrol-1-yl)-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 67791576 |
| Molecular Formula | C13H9Cl2NO4 |
| Molecular Weight | 314.12 g/mol |
| Exact Mass | 312.99 |
| IUPAC Name | (2S)-2-(3,4-dichloro-2,5-dioxopyrrol-1-yl)-3-phenylpropanoic acid |
| SMILES | O=C(O)[C@H](Cc1ccccc1)N1C(=O)C(Cl)=C(Cl)C1=O |
| InChI | InChI=1S/C13H9Cl2NO4/c14-9-10(15)12(18)16(11(9)17)8(13(19)20)6-7-4-2-1-3-5-7/h1-5,8H,6H2,(H,19,20)/t8-/m0/s1 |
| InChIKey | XEIURXNCQKWGQI-QMMMGPOBSA-N |
| XLogP | 1.74 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.12 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|