2-(1,3-dioxoisoindol-2-yl)-3-(3-fluorophenyl)propanoic acid

C17H12FNO4 — CID 175668475

IUPAC2-(1,3-dioxoisoindol-2-yl)-3-(3-fluorophenyl)propanoic acid
SMILESO=C(O)C(Cc1cccc(F)c1)N1C(=O)c2ccccc2C1=O
InChIInChI=1S/C17H12FNO4/c18-11-5-3-4-10(8-11)9-14(17(22)23)19-15(20)12-6-1-2-7-13(12)16(19)21/h1-8,14H,9H2,(H,22,23)
InChIKeyYVXHWTMIYKXJHK-UHFFFAOYSA-N
MW313.28 g/mol
LogP2.12
Rot. Bonds4

About 2-(1,3-dioxoisoindol-2-yl)-3-(3-fluorophenyl)propanoic acid

2-(1,3-dioxoisoindol-2-yl)-3-(3-fluorophenyl)propanoic acid (PubChem CID 175668475) has the molecular formula C17H12FNO4 and a molecular weight of 313.28 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-3-(3-fluorophenyl)propanoic acid.

Molecular Properties

Compound Name2-(1,3-dioxoisoindol-2-yl)-3-(3-fluorophenyl)propanoic acid
PubChem CID175668475
Molecular FormulaC17H12FNO4
Molecular Weight313.28 g/mol
Exact Mass313.08
IUPAC Name2-(1,3-dioxoisoindol-2-yl)-3-(3-fluorophenyl)propanoic acid
SMILESO=C(O)C(Cc1cccc(F)c1)N1C(=O)c2ccccc2C1=O
InChIInChI=1S/C17H12FNO4/c18-11-5-3-4-10(8-11)9-14(17(22)23)19-15(20)12-6-1-2-7-13(12)16(19)21/h1-8,14H,9H2,(H,22,23)
InChIKeyYVXHWTMIYKXJHK-UHFFFAOYSA-N
XLogP2.12
TPSA74.68 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500313.28
LogP ≤ 52.12
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phthalimide', 'substructure': 'N/A'}

Analyze 2-(1,3-dioxoisoindol-2-yl)-3-(3-fluorophenyl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(1,3-dioxoisoindol-2-yl)-3-(3-fluorophenyl)propanoic acid?
The IUPAC name of 2-(1,3-dioxoisoindol-2-yl)-3-(3-fluorophenyl)propanoic acid (CID 175668475) is 2-(1,3-dioxoisoindol-2-yl)-3-(3-fluorophenyl)propanoic acid.
What is the SMILES notation for 2-(1,3-dioxoisoindol-2-yl)-3-(3-fluorophenyl)propanoic acid?
The canonical SMILES for 2-(1,3-dioxoisoindol-2-yl)-3-(3-fluorophenyl)propanoic acid is O=C(O)C(Cc1cccc(F)c1)N1C(=O)c2ccccc2C1=O.
What is the InChIKey of 2-(1,3-dioxoisoindol-2-yl)-3-(3-fluorophenyl)propanoic acid?
The InChIKey is YVXHWTMIYKXJHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12FNO4/c18-11-5-3-4-10(8-11)9-14(17(22)23)19-15(20)12-6-1-2-7-13(12)16(19)21/h1-8,14H,9H2,(H,22,23).
What are the key properties of 2-(1,3-dioxoisoindol-2-yl)-3-(3-fluorophenyl)propanoic acid?
2-(1,3-dioxoisoindol-2-yl)-3-(3-fluorophenyl)propanoic acid has a molecular weight of 313.28 g/mol, XLogP of 2.12, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-dioxoisoindol-2-yl)-3-(3-fluorophenyl)propanoic acid is sourced from PubChem (CID 175668475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).