C15H17NO4 — CID 130960815
2-(1,3-dioxoisoindol-2-yl)-4,4-dimethylpentanoic acid (PubChem CID 130960815) has the molecular formula C15H17NO4 and a molecular weight of 275.30 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-4,4-dimethylpentanoic acid.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-4,4-dimethylpentanoic acid |
|---|---|
| PubChem CID | 130960815 |
| Molecular Formula | C15H17NO4 |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-4,4-dimethylpentanoic acid |
| SMILES | CC(C)(C)CC(C(=O)O)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C15H17NO4/c1-15(2,3)8-11(14(19)20)16-12(17)9-6-4-5-7-10(9)13(16)18/h4-7,11H,8H2,1-3H3,(H,19,20) |
| InChIKey | YOUCPFXSCWFCGY-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|