C15H15NO6 — CID 18640718
(2S)-2-(1,3-dioxoisoindol-2-yl)-5-ethoxy-5-oxopentanoic acid (PubChem CID 18640718) has the molecular formula C15H15NO6 and a molecular weight of 305.29 g/mol. Its IUPAC name is (2S)-2-(1,3-dioxoisoindol-2-yl)-5-ethoxy-5-oxopentanoic acid.
| Compound Name | (2S)-2-(1,3-dioxoisoindol-2-yl)-5-ethoxy-5-oxopentanoic acid |
|---|---|
| PubChem CID | 18640718 |
| Molecular Formula | C15H15NO6 |
| Molecular Weight | 305.29 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | (2S)-2-(1,3-dioxoisoindol-2-yl)-5-ethoxy-5-oxopentanoic acid |
| SMILES | CCOC(=O)CC[C@@H](C(=O)O)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C15H15NO6/c1-2-22-12(17)8-7-11(15(20)21)16-13(18)9-5-3-4-6-10(9)14(16)19/h3-6,11H,2,7-8H2,1H3,(H,20,21)/t11-/m0/s1 |
| InChIKey | PLULWAHYICGVGH-NSHDSACASA-N |
| XLogP | 1.08 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.29 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|