C13H13NO5 — CID 11139950
methyl (2S)-2-(1,3-dioxoisoindol-2-yl)-4-hydroxybutanoate (PubChem CID 11139950) has the molecular formula C13H13NO5 and a molecular weight of 263.25 g/mol. Its IUPAC name is methyl (2S)-2-(1,3-dioxoisoindol-2-yl)-4-hydroxybutanoate.
| Compound Name | methyl (2S)-2-(1,3-dioxoisoindol-2-yl)-4-hydroxybutanoate |
|---|---|
| PubChem CID | 11139950 |
| Molecular Formula | C13H13NO5 |
| Molecular Weight | 263.25 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | methyl (2S)-2-(1,3-dioxoisoindol-2-yl)-4-hydroxybutanoate |
| SMILES | COC(=O)[C@H](CCO)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C13H13NO5/c1-19-13(18)10(6-7-15)14-11(16)8-4-2-3-5-9(8)12(14)17/h2-5,10,15H,6-7H2,1H3/t10-/m0/s1 |
| InChIKey | PKDOBNRYPBTASK-JTQLQIEISA-N |
| XLogP | 0.21 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.25 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|