methyl (2S)-2-(1,3-dioxoisoindol-2-yl)-4-hydroxybutanoate

C13H13NO5 — CID 11139950

IUPACmethyl (2S)-2-(1,3-dioxoisoindol-2-yl)-4-hydroxybutanoate
SMILESCOC(=O)[C@H](CCO)N1C(=O)c2ccccc2C1=O
InChIInChI=1S/C13H13NO5/c1-19-13(18)10(6-7-15)14-11(16)8-4-2-3-5-9(8)12(14)17/h2-5,10,15H,6-7H2,1H3/t10-/m0/s1
InChIKeyPKDOBNRYPBTASK-JTQLQIEISA-N
MW263.25 g/mol
LogP0.21
Rot. Bonds4

About methyl (2S)-2-(1,3-dioxoisoindol-2-yl)-4-hydroxybutanoate

methyl (2S)-2-(1,3-dioxoisoindol-2-yl)-4-hydroxybutanoate (PubChem CID 11139950) has the molecular formula C13H13NO5 and a molecular weight of 263.25 g/mol. Its IUPAC name is methyl (2S)-2-(1,3-dioxoisoindol-2-yl)-4-hydroxybutanoate.

Molecular Properties

Compound Namemethyl (2S)-2-(1,3-dioxoisoindol-2-yl)-4-hydroxybutanoate
PubChem CID11139950
Molecular FormulaC13H13NO5
Molecular Weight263.25 g/mol
Exact Mass263.08
IUPAC Namemethyl (2S)-2-(1,3-dioxoisoindol-2-yl)-4-hydroxybutanoate
SMILESCOC(=O)[C@H](CCO)N1C(=O)c2ccccc2C1=O
InChIInChI=1S/C13H13NO5/c1-19-13(18)10(6-7-15)14-11(16)8-4-2-3-5-9(8)12(14)17/h2-5,10,15H,6-7H2,1H3/t10-/m0/s1
InChIKeyPKDOBNRYPBTASK-JTQLQIEISA-N
XLogP0.21
TPSA83.91 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500263.25
LogP ≤ 50.21
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phthalimide', 'substructure': 'N/A'}

Analyze methyl (2S)-2-(1,3-dioxoisoindol-2-yl)-4-hydroxybutanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (2S)-2-(1,3-dioxoisoindol-2-yl)-4-hydroxybutanoate?
The IUPAC name of methyl (2S)-2-(1,3-dioxoisoindol-2-yl)-4-hydroxybutanoate (CID 11139950) is methyl (2S)-2-(1,3-dioxoisoindol-2-yl)-4-hydroxybutanoate.
What is the SMILES notation for methyl (2S)-2-(1,3-dioxoisoindol-2-yl)-4-hydroxybutanoate?
The canonical SMILES for methyl (2S)-2-(1,3-dioxoisoindol-2-yl)-4-hydroxybutanoate is COC(=O)[C@H](CCO)N1C(=O)c2ccccc2C1=O.
What is the InChIKey of methyl (2S)-2-(1,3-dioxoisoindol-2-yl)-4-hydroxybutanoate?
The InChIKey is PKDOBNRYPBTASK-JTQLQIEISA-N. The full InChI is InChI=1S/C13H13NO5/c1-19-13(18)10(6-7-15)14-11(16)8-4-2-3-5-9(8)12(14)17/h2-5,10,15H,6-7H2,1H3/t10-/m0/s1.
What are the key properties of methyl (2S)-2-(1,3-dioxoisoindol-2-yl)-4-hydroxybutanoate?
methyl (2S)-2-(1,3-dioxoisoindol-2-yl)-4-hydroxybutanoate has a molecular weight of 263.25 g/mol, XLogP of 0.21, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2S)-2-(1,3-dioxoisoindol-2-yl)-4-hydroxybutanoate is sourced from PubChem (CID 11139950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).