C15H14BrNO6 — CID 7590540
dimethyl (2R,4R)-2-bromo-4-(1,3-dioxoisoindol-2-yl)pentanedioate (PubChem CID 7590540) has the molecular formula C15H14BrNO6 and a molecular weight of 384.18 g/mol. Its IUPAC name is dimethyl (2R,4R)-2-bromo-4-(1,3-dioxoisoindol-2-yl)pentanedioate.
| Compound Name | dimethyl (2R,4R)-2-bromo-4-(1,3-dioxoisoindol-2-yl)pentanedioate |
|---|---|
| PubChem CID | 7590540 |
| Molecular Formula | C15H14BrNO6 |
| Molecular Weight | 384.18 g/mol |
| Exact Mass | 383.00 |
| IUPAC Name | dimethyl (2R,4R)-2-bromo-4-(1,3-dioxoisoindol-2-yl)pentanedioate |
| SMILES | COC(=O)[C@H](Br)C[C@H](C(=O)OC)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C15H14BrNO6/c1-22-14(20)10(16)7-11(15(21)23-2)17-12(18)8-5-3-4-6-9(8)13(17)19/h3-6,10-11H,7H2,1-2H3/t10-,11-/m1/s1 |
| InChIKey | KGQDNHFIAOABNF-GHMZBOCLSA-N |
| XLogP | 1.15 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.18 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|