C14H15NO5S — CID 11876874
methyl (2S)-2-(1,3-dioxoisoindol-2-yl)-4-[(R)-methylsulfinyl]butanoate (PubChem CID 11876874) has the molecular formula C14H15NO5S and a molecular weight of 309.34 g/mol. Its IUPAC name is methyl (2S)-2-(1,3-dioxoisoindol-2-yl)-4-[(R)-methylsulfinyl]butanoate.
| Compound Name | methyl (2S)-2-(1,3-dioxoisoindol-2-yl)-4-[(R)-methylsulfinyl]butanoate |
|---|---|
| PubChem CID | 11876874 |
| Molecular Formula | C14H15NO5S |
| Molecular Weight | 309.34 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | methyl (2S)-2-(1,3-dioxoisoindol-2-yl)-4-[(R)-methylsulfinyl]butanoate |
| SMILES | COC(=O)[C@H](CC[S@@](C)=O)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C14H15NO5S/c1-20-14(18)11(7-8-21(2)19)15-12(16)9-5-3-4-6-10(9)13(15)17/h3-6,11H,7-8H2,1-2H3/t11-,21+/m0/s1 |
| InChIKey | DGMCKCSWJWXVQK-WIUDPPPLSA-N |
| XLogP | 0.59 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.34 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|