C16H19NO4 — CID 101207744
methyl 2-(1,3-dioxoisoindol-2-yl)heptanoate (PubChem CID 101207744) has the molecular formula C16H19NO4 and a molecular weight of 289.33 g/mol. Its IUPAC name is methyl 2-(1,3-dioxoisoindol-2-yl)heptanoate.
| Compound Name | methyl 2-(1,3-dioxoisoindol-2-yl)heptanoate |
|---|---|
| PubChem CID | 101207744 |
| Molecular Formula | C16H19NO4 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | methyl 2-(1,3-dioxoisoindol-2-yl)heptanoate |
| SMILES | CCCCCC(C(=O)OC)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C16H19NO4/c1-3-4-5-10-13(16(20)21-2)17-14(18)11-8-6-7-9-12(11)15(17)19/h6-9,13H,3-5,10H2,1-2H3 |
| InChIKey | RNHXJTJQYMSRGN-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|