C16H18N2O7 — CID 144998859
methyl 2-amino-3-[(2R)-2-(1,3-dioxoisoindol-2-yl)-3-methoxy-3-oxopropoxy]propanoate (PubChem CID 144998859) has the molecular formula C16H18N2O7 and a molecular weight of 350.33 g/mol. Its IUPAC name is methyl 2-amino-3-[(2R)-2-(1,3-dioxoisoindol-2-yl)-3-methoxy-3-oxopropoxy]propanoate.
| Compound Name | methyl 2-amino-3-[(2R)-2-(1,3-dioxoisoindol-2-yl)-3-methoxy-3-oxopropoxy]propanoate |
|---|---|
| PubChem CID | 144998859 |
| Molecular Formula | C16H18N2O7 |
| Molecular Weight | 350.33 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | methyl 2-amino-3-[(2R)-2-(1,3-dioxoisoindol-2-yl)-3-methoxy-3-oxopropoxy]propanoate |
| SMILES | COC(=O)C(N)COC[C@H](C(=O)OC)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C16H18N2O7/c1-23-15(21)11(17)7-25-8-12(16(22)24-2)18-13(19)9-5-3-4-6-10(9)14(18)20/h3-6,11-12H,7-8,17H2,1-2H3/t11?,12-/m1/s1 |
| InChIKey | KOXUQMVIVKWKBM-PIJUOVFKSA-N |
| XLogP | -0.66 |
| TPSA | 125.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.33 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|