C17H20N2O5 — CID 100964211
methyl (2S,4S)-4-amino-2-(1,3-dioxoisoindol-2-yl)-6-methyl-3-oxoheptanoate (PubChem CID 100964211) has the molecular formula C17H20N2O5 and a molecular weight of 332.36 g/mol. Its IUPAC name is methyl (2S,4S)-4-amino-2-(1,3-dioxoisoindol-2-yl)-6-methyl-3-oxoheptanoate.
| Compound Name | methyl (2S,4S)-4-amino-2-(1,3-dioxoisoindol-2-yl)-6-methyl-3-oxoheptanoate |
|---|---|
| PubChem CID | 100964211 |
| Molecular Formula | C17H20N2O5 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | methyl (2S,4S)-4-amino-2-(1,3-dioxoisoindol-2-yl)-6-methyl-3-oxoheptanoate |
| SMILES | COC(=O)[C@H](C(=O)[C@@H](N)CC(C)C)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C17H20N2O5/c1-9(2)8-12(18)14(20)13(17(23)24-3)19-15(21)10-6-4-5-7-11(10)16(19)22/h4-7,9,12-13H,8,18H2,1-3H3/t12-,13-/m0/s1 |
| InChIKey | ZKSXGWPVSAHWPE-STQMWFEESA-N |
| XLogP | 0.77 |
| TPSA | 106.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|