C14H14N2O5 — CID 100964209
methyl (2S,4S)-4-amino-2-(1,3-dioxoisoindol-2-yl)-3-oxopentanoate (PubChem CID 100964209) has the molecular formula C14H14N2O5 and a molecular weight of 290.28 g/mol. Its IUPAC name is methyl (2S,4S)-4-amino-2-(1,3-dioxoisoindol-2-yl)-3-oxopentanoate.
| Compound Name | methyl (2S,4S)-4-amino-2-(1,3-dioxoisoindol-2-yl)-3-oxopentanoate |
|---|---|
| PubChem CID | 100964209 |
| Molecular Formula | C14H14N2O5 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | methyl (2S,4S)-4-amino-2-(1,3-dioxoisoindol-2-yl)-3-oxopentanoate |
| SMILES | COC(=O)[C@H](C(=O)[C@H](C)N)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C14H14N2O5/c1-7(15)11(17)10(14(20)21-2)16-12(18)8-5-3-4-6-9(8)13(16)19/h3-7,10H,15H2,1-2H3/t7-,10-/m0/s1 |
| InChIKey | CFMWFNJWHOHALU-XVKPBYJWSA-N |
| XLogP | -0.26 |
| TPSA | 106.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|