C18H22N2O5 — CID 11067976
methyl (2S,3S)-4-(tert-butylamino)-2-(1,3-dioxoisoindol-2-yl)-3-methyl-4-oxobutanoate (PubChem CID 11067976) has the molecular formula C18H22N2O5 and a molecular weight of 346.38 g/mol. Its IUPAC name is methyl (2S,3S)-4-(tert-butylamino)-2-(1,3-dioxoisoindol-2-yl)-3-methyl-4-oxobutanoate.
| Compound Name | methyl (2S,3S)-4-(tert-butylamino)-2-(1,3-dioxoisoindol-2-yl)-3-methyl-4-oxobutanoate |
|---|---|
| PubChem CID | 11067976 |
| Molecular Formula | C18H22N2O5 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | methyl (2S,3S)-4-(tert-butylamino)-2-(1,3-dioxoisoindol-2-yl)-3-methyl-4-oxobutanoate |
| SMILES | COC(=O)[C@H]([C@H](C)C(=O)NC(C)(C)C)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C18H22N2O5/c1-10(14(21)19-18(2,3)4)13(17(24)25-5)20-15(22)11-8-6-7-9-12(11)16(20)23/h6-10,13H,1-5H3,(H,19,21)/t10-,13-/m0/s1 |
| InChIKey | ITGRSLZOXATNPC-GWCFXTLKSA-N |
| XLogP | 1.38 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|