C13H12NNaO4 — CID 19205516
sodium 2-(1,3-dioxoisoindol-2-yl)-3-methylbutanoate (PubChem CID 19205516) has the molecular formula C13H12NNaO4 and a molecular weight of 269.23 g/mol. Its IUPAC name is sodium 2-(1,3-dioxoisoindol-2-yl)-3-methylbutanoate.
| Compound Name | sodium 2-(1,3-dioxoisoindol-2-yl)-3-methylbutanoate |
|---|---|
| PubChem CID | 19205516 |
| Molecular Formula | C13H12NNaO4 |
| Molecular Weight | 269.23 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | sodium 2-(1,3-dioxoisoindol-2-yl)-3-methylbutanoate |
| SMILES | CC(C)C(C(=O)[O-])N1C(=O)c2ccccc2C1=O.[Na+] |
| InChI | InChI=1S/C13H13NO4.Na/c1-7(2)10(13(17)18)14-11(15)8-5-3-4-6-9(8)12(14)16;/h3-7,10H,1-2H3,(H,17,18);/q;+1/p-1 |
| InChIKey | TYNAZGWBMJLURA-UHFFFAOYSA-M |
| XLogP | -2.94 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.23 |
| LogP ≤ 5 | -2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|