C15H17NO6S — CID 140522504
[3-(1,3-dioxoisoindol-2-yl)-4-methyl-2-oxopentyl] methanesulfonate (PubChem CID 140522504) has the molecular formula C15H17NO6S and a molecular weight of 339.37 g/mol. Its IUPAC name is [3-(1,3-dioxoisoindol-2-yl)-4-methyl-2-oxopentyl] methanesulfonate.
| Compound Name | [3-(1,3-dioxoisoindol-2-yl)-4-methyl-2-oxopentyl] methanesulfonate |
|---|---|
| PubChem CID | 140522504 |
| Molecular Formula | C15H17NO6S |
| Molecular Weight | 339.37 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | [3-(1,3-dioxoisoindol-2-yl)-4-methyl-2-oxopentyl] methanesulfonate |
| SMILES | CC(C)C(C(=O)COS(C)(=O)=O)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C15H17NO6S/c1-9(2)13(12(17)8-22-23(3,20)21)16-14(18)10-6-4-5-7-11(10)15(16)19/h4-7,9,13H,8H2,1-3H3 |
| InChIKey | RVOOZGNPOMCATF-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 97.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.37 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|