C13H14N2O3 — CID 15513937
(2S)-2-(1,3-dioxoisoindol-2-yl)-3-methylbutanamide (PubChem CID 15513937) has the molecular formula C13H14N2O3 and a molecular weight of 246.27 g/mol. Its IUPAC name is (2S)-2-(1,3-dioxoisoindol-2-yl)-3-methylbutanamide.
| Compound Name | (2S)-2-(1,3-dioxoisoindol-2-yl)-3-methylbutanamide |
|---|---|
| PubChem CID | 15513937 |
| Molecular Formula | C13H14N2O3 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | (2S)-2-(1,3-dioxoisoindol-2-yl)-3-methylbutanamide |
| SMILES | CC(C)[C@@H](C(N)=O)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C13H14N2O3/c1-7(2)10(11(14)16)15-12(17)8-5-3-4-6-9(8)13(15)18/h3-7,10H,1-2H3,(H2,14,16)/t10-/m0/s1 |
| InChIKey | SQNDCUBAGKNUCD-JTQLQIEISA-N |
| XLogP | 0.79 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|