C17H14N2O4 — CID 101037296
(2R,3S)-2-(1,3-dioxoisoindol-2-yl)-3-hydroxy-3-phenylpropanamide (PubChem CID 101037296) has the molecular formula C17H14N2O4 and a molecular weight of 310.31 g/mol. Its IUPAC name is (2R,3S)-2-(1,3-dioxoisoindol-2-yl)-3-hydroxy-3-phenylpropanamide.
| Compound Name | (2R,3S)-2-(1,3-dioxoisoindol-2-yl)-3-hydroxy-3-phenylpropanamide |
|---|---|
| PubChem CID | 101037296 |
| Molecular Formula | C17H14N2O4 |
| Molecular Weight | 310.31 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | (2R,3S)-2-(1,3-dioxoisoindol-2-yl)-3-hydroxy-3-phenylpropanamide |
| SMILES | NC(=O)[C@@H]([C@@H](O)c1ccccc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C17H14N2O4/c18-15(21)13(14(20)10-6-2-1-3-7-10)19-16(22)11-8-4-5-9-12(11)17(19)23/h1-9,13-14,20H,(H2,18,21)/t13-,14+/m1/s1 |
| InChIKey | SSMOEZXTCUIGJX-KGLIPLIRSA-N |
| XLogP | 0.87 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.31 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|