C21H24ClN3O4 — CID 162171387
2-[(1S,2R)-1-hydroxy-3-oxo-1-pyridin-4-yl-3-pyrrolidin-1-ylpropan-2-yl]isoindole-1,3-dione;methane;hydrochloride (PubChem CID 162171387) has the molecular formula C21H24ClN3O4 and a molecular weight of 417.89 g/mol. Its IUPAC name is 2-[(1S,2R)-1-hydroxy-3-oxo-1-pyridin-4-yl-3-pyrrolidin-1-ylpropan-2-yl]isoindole-1,3-dione;methane;hydrochloride.
| Compound Name | 2-[(1S,2R)-1-hydroxy-3-oxo-1-pyridin-4-yl-3-pyrrolidin-1-ylpropan-2-yl]isoindole-1,3-dione;methane;hydrochloride |
|---|---|
| PubChem CID | 162171387 |
| Molecular Formula | C21H24ClN3O4 |
| Molecular Weight | 417.89 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | 2-[(1S,2R)-1-hydroxy-3-oxo-1-pyridin-4-yl-3-pyrrolidin-1-ylpropan-2-yl]isoindole-1,3-dione;methane;hydrochloride |
| SMILES | C.Cl.O=C([C@@H]([C@@H](O)c1ccncc1)N1C(=O)c2ccccc2C1=O)N1CCCC1 |
| InChI | InChI=1S/C20H19N3O4.CH4.ClH/c24-17(13-7-9-21-10-8-13)16(20(27)22-11-3-4-12-22)23-18(25)14-5-1-2-6-15(14)19(23)26;;/h1-2,5-10,16-17,24H,3-4,11-12H2;1H4;1H/t16-,17+;;/m1../s1 |
| InChIKey | MRRHVMLRFOMTDJ-LWPKXAGOSA-N |
| XLogP | 2.46 |
| TPSA | 90.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.89 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|