C19H25Cl2N3O2 — CID 68956648
2-(benzylamino)-3-hydroxy-3-pyridin-4-yl-1-pyrrolidin-1-ylpropan-1-one;dihydrochloride (PubChem CID 68956648) has the molecular formula C19H25Cl2N3O2 and a molecular weight of 398.33 g/mol. Its IUPAC name is 2-(benzylamino)-3-hydroxy-3-pyridin-4-yl-1-pyrrolidin-1-ylpropan-1-one;dihydrochloride.
| Compound Name | 2-(benzylamino)-3-hydroxy-3-pyridin-4-yl-1-pyrrolidin-1-ylpropan-1-one;dihydrochloride |
|---|---|
| PubChem CID | 68956648 |
| Molecular Formula | C19H25Cl2N3O2 |
| Molecular Weight | 398.33 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | 2-(benzylamino)-3-hydroxy-3-pyridin-4-yl-1-pyrrolidin-1-ylpropan-1-one;dihydrochloride |
| SMILES | Cl.Cl.O=C(C(NCc1ccccc1)C(O)c1ccncc1)N1CCCC1 |
| InChI | InChI=1S/C19H23N3O2.2ClH/c23-18(16-8-10-20-11-9-16)17(19(24)22-12-4-5-13-22)21-14-15-6-2-1-3-7-15;;/h1-3,6-11,17-18,21,23H,4-5,12-14H2;2*1H |
| InChIKey | HVZRYXNKDSPXMC-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.33 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |