C26H19N3O5 — CID 14542722
2,2-bis(1,3-dioxoisoindol-2-yl)-N-[(1S)-1-phenylethyl]acetamide (PubChem CID 14542722) has the molecular formula C26H19N3O5 and a molecular weight of 453.45 g/mol. Its IUPAC name is 2,2-bis(1,3-dioxoisoindol-2-yl)-N-[(1S)-1-phenylethyl]acetamide.
| Compound Name | 2,2-bis(1,3-dioxoisoindol-2-yl)-N-[(1S)-1-phenylethyl]acetamide |
|---|---|
| PubChem CID | 14542722 |
| Molecular Formula | C26H19N3O5 |
| Molecular Weight | 453.45 g/mol |
| Exact Mass | 453.13 |
| IUPAC Name | 2,2-bis(1,3-dioxoisoindol-2-yl)-N-[(1S)-1-phenylethyl]acetamide |
| SMILES | C[C@H](NC(=O)C(N1C(=O)c2ccccc2C1=O)N1C(=O)c2ccccc2C1=O)c1ccccc1 |
| InChI | InChI=1S/C26H19N3O5/c1-15(16-9-3-2-4-10-16)27-21(30)22(28-23(31)17-11-5-6-12-18(17)24(28)32)29-25(33)19-13-7-8-14-20(19)26(29)34/h2-15,22H,1H3,(H,27,30)/t15-/m0/s1 |
| InChIKey | XXKSLXPQLIOPGE-HNNXBMFYSA-N |
| XLogP | 2.78 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.45 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|