C17H13NO7 — CID 13454083
3-(3,4-dihydroxyphenyl)-2-(1,3-dioxoisoindol-2-yl)-3-hydroxypropanoic acid (PubChem CID 13454083) has the molecular formula C17H13NO7 and a molecular weight of 343.29 g/mol. Its IUPAC name is 3-(3,4-dihydroxyphenyl)-2-(1,3-dioxoisoindol-2-yl)-3-hydroxypropanoic acid.
| Compound Name | 3-(3,4-dihydroxyphenyl)-2-(1,3-dioxoisoindol-2-yl)-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 13454083 |
| Molecular Formula | C17H13NO7 |
| Molecular Weight | 343.29 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | 3-(3,4-dihydroxyphenyl)-2-(1,3-dioxoisoindol-2-yl)-3-hydroxypropanoic acid |
| SMILES | O=C(O)C(C(O)c1ccc(O)c(O)c1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C17H13NO7/c19-11-6-5-8(7-12(11)20)14(21)13(17(24)25)18-15(22)9-3-1-2-4-10(9)16(18)23/h1-7,13-14,19-21H,(H,24,25) |
| InChIKey | GOARNQSMYSYKHQ-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 135.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.29 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|