C21H21NO5 — CID 67594908
(2S,3S)-3-(1,3-dioxoisoindol-2-yl)-2-hydroxy-5-methyl-4-phenylhexanoic acid (PubChem CID 67594908) has the molecular formula C21H21NO5 and a molecular weight of 367.40 g/mol. Its IUPAC name is (2S,3S)-3-(1,3-dioxoisoindol-2-yl)-2-hydroxy-5-methyl-4-phenylhexanoic acid.
| Compound Name | (2S,3S)-3-(1,3-dioxoisoindol-2-yl)-2-hydroxy-5-methyl-4-phenylhexanoic acid |
|---|---|
| PubChem CID | 67594908 |
| Molecular Formula | C21H21NO5 |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | (2S,3S)-3-(1,3-dioxoisoindol-2-yl)-2-hydroxy-5-methyl-4-phenylhexanoic acid |
| SMILES | CC(C)C(c1ccccc1)[C@@H]([C@H](O)C(=O)O)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C21H21NO5/c1-12(2)16(13-8-4-3-5-9-13)17(18(23)21(26)27)22-19(24)14-10-6-7-11-15(14)20(22)25/h3-12,16-18,23H,1-2H3,(H,26,27)/t16?,17-,18-/m0/s1 |
| InChIKey | WSJPMUGTOCNWLW-FQECFTEESA-N |
| XLogP | 2.54 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|