C14H15NO4 — CID 46895638
(3R)-3-(1,3-dioxoisoindol-2-yl)-4-methylpentanoic acid (PubChem CID 46895638) has the molecular formula C14H15NO4 and a molecular weight of 261.28 g/mol. Its IUPAC name is (3R)-3-(1,3-dioxoisoindol-2-yl)-4-methylpentanoic acid.
| Compound Name | (3R)-3-(1,3-dioxoisoindol-2-yl)-4-methylpentanoic acid |
|---|---|
| PubChem CID | 46895638 |
| Molecular Formula | C14H15NO4 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | (3R)-3-(1,3-dioxoisoindol-2-yl)-4-methylpentanoic acid |
| SMILES | CC(C)[C@@H](CC(=O)O)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C14H15NO4/c1-8(2)11(7-12(16)17)15-13(18)9-5-3-4-6-10(9)14(15)19/h3-6,8,11H,7H2,1-2H3,(H,16,17)/t11-/m1/s1 |
| InChIKey | LQJIPPVANXQJFS-LLVKDONJSA-N |
| XLogP | 1.78 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|