C15H17NO4 — CID 71583338
3-[(1,3-dioxoisoindol-2-yl)methyl]-4-methylpentanoic acid (PubChem CID 71583338) has the molecular formula C15H17NO4 and a molecular weight of 275.30 g/mol. Its IUPAC name is 3-[(1,3-dioxoisoindol-2-yl)methyl]-4-methylpentanoic acid.
| Compound Name | 3-[(1,3-dioxoisoindol-2-yl)methyl]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 71583338 |
| Molecular Formula | C15H17NO4 |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | 3-[(1,3-dioxoisoindol-2-yl)methyl]-4-methylpentanoic acid |
| SMILES | CC(C)C(CC(=O)O)CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C15H17NO4/c1-9(2)10(7-13(17)18)8-16-14(19)11-5-3-4-6-12(11)15(16)20/h3-6,9-10H,7-8H2,1-2H3,(H,17,18) |
| InChIKey | IUNBAKBXEYKOJD-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|