C14H15NO4 — CID 65222152
2-[(1,3-dioxoisoindol-2-yl)methyl]-3-methylbutanoic acid (PubChem CID 65222152) has the molecular formula C14H15NO4 and a molecular weight of 261.28 g/mol. Its IUPAC name is 2-[(1,3-dioxoisoindol-2-yl)methyl]-3-methylbutanoic acid.
| Compound Name | 2-[(1,3-dioxoisoindol-2-yl)methyl]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 65222152 |
| Molecular Formula | C14H15NO4 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | 2-[(1,3-dioxoisoindol-2-yl)methyl]-3-methylbutanoic acid |
| SMILES | CC(C)C(CN1C(=O)c2ccccc2C1=O)C(=O)O |
| InChI | InChI=1S/C14H15NO4/c1-8(2)11(14(18)19)7-15-12(16)9-5-3-4-6-10(9)13(15)17/h3-6,8,11H,7H2,1-2H3,(H,18,19) |
| InChIKey | UVGUFIHLQIEIHT-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|