C16H20N2O4 — CID 68771693
(2S)-2-[2-(1,3-dioxoisoindol-2-yl)ethylamino]-3,3-dimethylbutanoic acid (PubChem CID 68771693) has the molecular formula C16H20N2O4 and a molecular weight of 304.35 g/mol. Its IUPAC name is (2S)-2-[2-(1,3-dioxoisoindol-2-yl)ethylamino]-3,3-dimethylbutanoic acid.
| Compound Name | (2S)-2-[2-(1,3-dioxoisoindol-2-yl)ethylamino]-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 68771693 |
| Molecular Formula | C16H20N2O4 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | (2S)-2-[2-(1,3-dioxoisoindol-2-yl)ethylamino]-3,3-dimethylbutanoic acid |
| SMILES | CC(C)(C)[C@H](NCCN1C(=O)c2ccccc2C1=O)C(=O)O |
| InChI | InChI=1S/C16H20N2O4/c1-16(2,3)12(15(21)22)17-8-9-18-13(19)10-6-4-5-7-11(10)14(18)20/h4-7,12,17H,8-9H2,1-3H3,(H,21,22)/t12-/m1/s1 |
| InChIKey | NEEIJKVQWQMRSR-GFCCVEGCSA-N |
| XLogP | 1.37 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|