C22H26N2O2 — CID 24626994
2-[4-[(2-methyl-1-phenylpropyl)amino]butyl]isoindole-1,3-dione (PubChem CID 24626994) has the molecular formula C22H26N2O2 and a molecular weight of 350.46 g/mol. Its IUPAC name is 2-[4-[(2-methyl-1-phenylpropyl)amino]butyl]isoindole-1,3-dione.
| Compound Name | 2-[4-[(2-methyl-1-phenylpropyl)amino]butyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 24626994 |
| Molecular Formula | C22H26N2O2 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | 2-[4-[(2-methyl-1-phenylpropyl)amino]butyl]isoindole-1,3-dione |
| SMILES | CC(C)C(NCCCCN1C(=O)c2ccccc2C1=O)c1ccccc1 |
| InChI | InChI=1S/C22H26N2O2/c1-16(2)20(17-10-4-3-5-11-17)23-14-8-9-15-24-21(25)18-12-6-7-13-19(18)22(24)26/h3-7,10-13,16,20,23H,8-9,14-15H2,1-2H3 |
| InChIKey | ZDXWVCXZMCDMSN-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|