C18H24N2O4 — CID 122099912
(2S,3S)-2-[4-(1,3-dioxoisoindol-2-yl)butylamino]-3-methylpentanoic acid (PubChem CID 122099912) has the molecular formula C18H24N2O4 and a molecular weight of 332.40 g/mol. Its IUPAC name is (2S,3S)-2-[4-(1,3-dioxoisoindol-2-yl)butylamino]-3-methylpentanoic acid.
| Compound Name | (2S,3S)-2-[4-(1,3-dioxoisoindol-2-yl)butylamino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 122099912 |
| Molecular Formula | C18H24N2O4 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | (2S,3S)-2-[4-(1,3-dioxoisoindol-2-yl)butylamino]-3-methylpentanoic acid |
| SMILES | CC[C@H](C)[C@H](NCCCCN1C(=O)c2ccccc2C1=O)C(=O)O |
| InChI | InChI=1S/C18H24N2O4/c1-3-12(2)15(18(23)24)19-10-6-7-11-20-16(21)13-8-4-5-9-14(13)17(20)22/h4-5,8-9,12,15,19H,3,6-7,10-11H2,1-2H3,(H,23,24)/t12-,15-/m0/s1 |
| InChIKey | UUKAYVDGEFVUKN-WFASDCNBSA-N |
| XLogP | 2.15 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|