C16H25NO2S — CID 10827727
(2S,3S)-2-(3-benzylsulfanylpropylamino)-3-methylpentanoic acid (PubChem CID 10827727) has the molecular formula C16H25NO2S and a molecular weight of 295.45 g/mol. Its IUPAC name is (2S,3S)-2-(3-benzylsulfanylpropylamino)-3-methylpentanoic acid.
| Compound Name | (2S,3S)-2-(3-benzylsulfanylpropylamino)-3-methylpentanoic acid |
|---|---|
| PubChem CID | 10827727 |
| Molecular Formula | C16H25NO2S |
| Molecular Weight | 295.45 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | (2S,3S)-2-(3-benzylsulfanylpropylamino)-3-methylpentanoic acid |
| SMILES | CC[C@H](C)[C@H](NCCCSCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C16H25NO2S/c1-3-13(2)15(16(18)19)17-10-7-11-20-12-14-8-5-4-6-9-14/h4-6,8-9,13,15,17H,3,7,10-12H2,1-2H3,(H,18,19)/t13-,15-/m0/s1 |
| InChIKey | JDNVGGLETZCCAM-ZFWWWQNUSA-N |
| XLogP | 3.40 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.45 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|