C9H19NO5S — CID 58931838
(2S)-3-methyl-2-(3-sulfopropylamino)pentanoic acid (PubChem CID 58931838) has the molecular formula C9H19NO5S and a molecular weight of 253.32 g/mol. Its IUPAC name is (2S)-3-methyl-2-(3-sulfopropylamino)pentanoic acid.
| Compound Name | (2S)-3-methyl-2-(3-sulfopropylamino)pentanoic acid |
|---|---|
| PubChem CID | 58931838 |
| Molecular Formula | C9H19NO5S |
| Molecular Weight | 253.32 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | (2S)-3-methyl-2-(3-sulfopropylamino)pentanoic acid |
| SMILES | CCC(C)[C@H](NCCCS(=O)(=O)O)C(=O)O |
| InChI | InChI=1S/C9H19NO5S/c1-3-7(2)8(9(11)12)10-5-4-6-16(13,14)15/h7-8,10H,3-6H2,1-2H3,(H,11,12)(H,13,14,15)/t7?,8-/m0/s1 |
| InChIKey | KMBWOVXKKMSFQR-MQWKRIRWSA-N |
| XLogP | 0.35 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.32 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|