C14H39N3O3S+2 — CID 88549743
3-(propan-2-ylamino)propane-1-sulfonic acid;bis(tetramethylazanium) (PubChem CID 88549743) has the molecular formula C14H39N3O3S+2 and a molecular weight of 329.55 g/mol. Its IUPAC name is 3-(propan-2-ylamino)propane-1-sulfonic acid;bis(tetramethylazanium).
| Compound Name | 3-(propan-2-ylamino)propane-1-sulfonic acid;bis(tetramethylazanium) |
|---|---|
| PubChem CID | 88549743 |
| Molecular Formula | C14H39N3O3S+2 |
| Molecular Weight | 329.55 g/mol |
| Exact Mass | 329.27 |
| IUPAC Name | 3-(propan-2-ylamino)propane-1-sulfonic acid;bis(tetramethylazanium) |
| SMILES | CC(C)NCCCS(=O)(=O)O.C[N+](C)(C)C.C[N+](C)(C)C |
| InChI | InChI=1S/C6H15NO3S.2C4H12N/c1-6(2)7-4-3-5-11(8,9)10;2*1-5(2,3)4/h6-7H,3-5H2,1-2H3,(H,8,9,10);2*1-4H3/q;2*+1 |
| InChIKey | KBMCIPLVQNRJCJ-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.55 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|