C11H26IN2O4S+ — CID 152866138
4-[[hydroxy(iodo)methyl]amino]butyl-dimethyl-(4-sulfobutyl)azanium (PubChem CID 152866138) has the molecular formula C11H26IN2O4S+ and a molecular weight of 409.31 g/mol. Its IUPAC name is 4-[[hydroxy(iodo)methyl]amino]butyl-dimethyl-(4-sulfobutyl)azanium.
| Compound Name | 4-[[hydroxy(iodo)methyl]amino]butyl-dimethyl-(4-sulfobutyl)azanium |
|---|---|
| PubChem CID | 152866138 |
| Molecular Formula | C11H26IN2O4S+ |
| Molecular Weight | 409.31 g/mol |
| Exact Mass | 409.07 |
| IUPAC Name | 4-[[hydroxy(iodo)methyl]amino]butyl-dimethyl-(4-sulfobutyl)azanium |
| SMILES | C[N+](C)(CCCCNC(O)I)CCCCS(=O)(=O)O |
| InChI | InChI=1S/C11H25IN2O4S/c1-14(2,8-4-3-7-13-11(12)15)9-5-6-10-19(16,17)18/h11,13,15H,3-10H2,1-2H3/p+1 |
| InChIKey | YFHXTKOZYAXNSM-UHFFFAOYSA-O |
| XLogP | 0.81 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.31 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|