C13H29N2O4S+ — CID 89398817
dimethyl-[2-(2-methylbutanoylamino)ethyl]-(4-sulfobutyl)azanium (PubChem CID 89398817) has the molecular formula C13H29N2O4S+ and a molecular weight of 309.45 g/mol. Its IUPAC name is dimethyl-[2-(2-methylbutanoylamino)ethyl]-(4-sulfobutyl)azanium.
| Compound Name | dimethyl-[2-(2-methylbutanoylamino)ethyl]-(4-sulfobutyl)azanium |
|---|---|
| PubChem CID | 89398817 |
| Molecular Formula | C13H29N2O4S+ |
| Molecular Weight | 309.45 g/mol |
| Exact Mass | 309.18 |
| IUPAC Name | dimethyl-[2-(2-methylbutanoylamino)ethyl]-(4-sulfobutyl)azanium |
| SMILES | CCC(C)C(=O)NCC[N+](C)(C)CCCCS(=O)(=O)O |
| InChI | InChI=1S/C13H28N2O4S/c1-5-12(2)13(16)14-8-10-15(3,4)9-6-7-11-20(17,18)19/h12H,5-11H2,1-4H3,(H-,14,16,17,18,19)/p+1 |
| InChIKey | CNMWZKVLTBKVET-UHFFFAOYSA-O |
| XLogP | 0.89 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.45 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|