C14H29NO5S — CID 59471098
4-[dimethyl-[3-(2-methylbutanoyloxy)propyl]azaniumyl]butane-1-sulfonate (PubChem CID 59471098) has the molecular formula C14H29NO5S and a molecular weight of 323.45 g/mol. Its IUPAC name is 4-[dimethyl-[3-(2-methylbutanoyloxy)propyl]azaniumyl]butane-1-sulfonate.
| Compound Name | 4-[dimethyl-[3-(2-methylbutanoyloxy)propyl]azaniumyl]butane-1-sulfonate |
|---|---|
| PubChem CID | 59471098 |
| Molecular Formula | C14H29NO5S |
| Molecular Weight | 323.45 g/mol |
| Exact Mass | 323.18 |
| IUPAC Name | 4-[dimethyl-[3-(2-methylbutanoyloxy)propyl]azaniumyl]butane-1-sulfonate |
| SMILES | CCC(C)C(=O)OCCC[N+](C)(C)CCCCS(=O)(=O)[O-] |
| InChI | InChI=1S/C14H29NO5S/c1-5-13(2)14(16)20-11-8-10-15(3,4)9-6-7-12-21(17,18)19/h13H,5-12H2,1-4H3 |
| InChIKey | HISDTBJRLRFSNI-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.45 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|