C23H44N2O10S2 — CID 160964800
4-[dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azaniumyl]butane-1-sulfonate;3-[dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azaniumyl]propane-1-sulfonate (PubChem CID 160964800) has the molecular formula C23H44N2O10S2 and a molecular weight of 572.74 g/mol. Its IUPAC name is 4-[dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azaniumyl]butane-1-sulfonate;3-[dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azaniumyl]propane-1-sulfonate.
| Compound Name | 4-[dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azaniumyl]butane-1-sulfonate;3-[dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azaniumyl]propane-1-sulfonate |
|---|---|
| PubChem CID | 160964800 |
| Molecular Formula | C23H44N2O10S2 |
| Molecular Weight | 572.74 g/mol |
| Exact Mass | 572.24 |
| IUPAC Name | 4-[dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azaniumyl]butane-1-sulfonate;3-[dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azaniumyl]propane-1-sulfonate |
| SMILES | C=C(C)C(=O)OCC[N+](C)(C)CCCCS(=O)(=O)[O-].C=C(C)C(=O)OCC[N+](C)(C)CCCS(=O)(=O)[O-] |
| InChI | InChI=1S/C12H23NO5S.C11H21NO5S/c1-11(2)12(14)18-9-8-13(3,4)7-5-6-10-19(15,16)17;1-10(2)11(13)17-8-7-12(3,4)6-5-9-18(14,15)16/h1,5-10H2,2-4H3;1,5-9H2,2-4H3 |
| InChIKey | SXMAWLPDNOMKCT-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 167.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.74 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|