C16H33N2O7S+ — CID 158248608
2-(dimethylamino)propanoic acid;dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]-(3-sulfopropyl)azanium (PubChem CID 158248608) has the molecular formula C16H33N2O7S+ and a molecular weight of 397.51 g/mol. Its IUPAC name is 2-(dimethylamino)propanoic acid;dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]-(3-sulfopropyl)azanium.
| Compound Name | 2-(dimethylamino)propanoic acid;dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]-(3-sulfopropyl)azanium |
|---|---|
| PubChem CID | 158248608 |
| Molecular Formula | C16H33N2O7S+ |
| Molecular Weight | 397.51 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | 2-(dimethylamino)propanoic acid;dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]-(3-sulfopropyl)azanium |
| SMILES | C=C(C)C(=O)OCC[N+](C)(C)CCCS(=O)(=O)O.CC(C(=O)O)N(C)C |
| InChI | InChI=1S/C11H21NO5S.C5H11NO2/c1-10(2)11(13)17-8-7-12(3,4)6-5-9-18(14,15)16;1-4(5(7)8)6(2)3/h1,5-9H2,2-4H3;4H,1-3H3,(H,7,8)/p+1 |
| InChIKey | GGKXXFOKRSPIHI-UHFFFAOYSA-O |
| XLogP | 0.48 |
| TPSA | 121.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.51 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|