C15H31NO7S — CID 87310530
butan-2-yl-ethyl-[2-(2-methylprop-2-enoyloxy)ethoxy]-(3-sulfopropyl)azanium hydroxide (PubChem CID 87310530) has the molecular formula C15H31NO7S and a molecular weight of 369.48 g/mol. Its IUPAC name is butan-2-yl-ethyl-[2-(2-methylprop-2-enoyloxy)ethoxy]-(3-sulfopropyl)azanium hydroxide.
| Compound Name | butan-2-yl-ethyl-[2-(2-methylprop-2-enoyloxy)ethoxy]-(3-sulfopropyl)azanium hydroxide |
|---|---|
| PubChem CID | 87310530 |
| Molecular Formula | C15H31NO7S |
| Molecular Weight | 369.48 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | butan-2-yl-ethyl-[2-(2-methylprop-2-enoyloxy)ethoxy]-(3-sulfopropyl)azanium hydroxide |
| SMILES | C=C(C)C(=O)OCCO[N+](CC)(CCCS(=O)(=O)O)C(C)CC.[OH-] |
| InChI | InChI=1S/C15H29NO6S.H2O/c1-6-14(5)16(7-2,9-8-12-23(18,19)20)22-11-10-21-15(17)13(3)4;/h14H,3,6-12H2,1-2,4-5H3;1H2 |
| InChIKey | RSMUMMJOYQABDC-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 119.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.48 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|